Tenitramine
Tenitramine
 |
| Names |
| IUPAC name
2-[2-[bis(2-nitrooxyethyl)amino]ethyl-(2-nitrooxyethyl)amino]ethyl nitrate |
| Identifiers |
| |
21946-79-2 N |
| 3D model (Jmol) |
Interactive image |
| ChemSpider |
146969 Y |
| PubChem |
168009 |
| UNII |
CKB16BAQ3S Y |
InChI=1S/C10H20N6O12/c17-13(18)25-7-3-11(4-8-26-14(19)20)1-2-12(5-9-27-15(21)22)6-10-28-16(23)24/h1-10H2 YKey: DLDKCSIJFIPYRK-UHFFFAOYSA-N Y
|
C(CN(CCO[N+](=O)[O-])CCO[N+](=O)[O-])N(CCO[N+](=O)[O-])CCO[N+](=O)[O-]
|
| Properties |
| |
C10H20N6O12 |
| Molar mass |
416.30 g/mol |
| Pharmacology |
| |
C01DA38 (WHO) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
N verify (what is Y N ?) |
| Infobox references |
|
|
Tenitramine (trade name Tinitran) is a nitrovasodilator.
References
|
|---|
|
| Forms | |
|---|
|
| Targets | |
|---|
|
NO donors (prodrugs) |
- NONOates (diazeniumdiolates): Diethylamine/NO (DEA/NO)
- Diethylenetriamine/NO (DETA/NO)
- GLO/NO
- JS-K
- Methylamine hexamethylene methylamine/NO (MAHMA/NO)
- PROLI/NO
- Spermine/NO (SPER/NO)
- V-PYRRO/NO
- Unsorted: CXL-1427
- FK-409
- FR144220
- FR146881
- N-Acetyl-N-acetoxy-4-chlorobenzenesulfonamide
|
|---|
|
Enzyme (inhibitors) | | NOS | | nNOS | |
|---|
| | iNOS |
- 1-Amino-2-hydroxyguanidine
- 2-Ethylaminoguanidine
- 2-Iminopiperidine
- 1400W
- AEITU
- Aminoguanidine (pimagedine)
- AMT
- AR-C 102222
- BYK-191023
- Canavanine
- Cindunistat (SD-6010)
- EITU
- IPTU
- MITU
- N5-(1-Iminoethyl)-L-ornithine (L-NIO)
- N6-(1-Iminoethyl)-L-lysine (L-NIL)
- Nω-Methyl-L-arginine (L-NMA)
- Ronopterin (VAS-203)
- TRIM
|
|---|
| | eNOS | |
|---|
| | Unsorted |
- Asymmetric dimethylarginine (ADMA)
- CKD-712
- Guanidinoethyldisulfide (GED)
- GW-273629
- Indospicine
- KD-7040
- Nitroarginine methyl ester (NAME)
- NCX-456
- NXN-462
- ONO-1714
- VAS-2381
|
|---|
|
|---|
| | Arginase |
- ABH
- Nω-Hydroxy-L-arginine (NOHA)
|
|---|
| | CAMK | |
|---|
|
|---|
|
| Others |
- Precursors: L-Arginine
- Nω-Hydroxy-L-arginine (NOHA)
|
|---|