trans-Diptoindonesin B

*trans*-Diptoindonesin B
Names

IUPAC name 5-[(2S,3S)-4-[(2S,3S)-5-[(Z)-2-(3,5-dihydroxyphenyl)ethenyl]-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-3-yl]-6-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-3-yl]benzene-1,3-diol
Identifiers
CAS Number	610757-17-0^Y
3D model (Jmol)	Interactive image
ChEBI	CHEBI:76196^N
PubChem	643710
SMILES OC1=CC(/C=C/C2=CC=C(O[C@H](C3=CC=C(O)C=C3)[C@H]4C5=CC(O)=CC6=C5[C@H](C7=CC(O)=CC(O)=C7)[C@@H](C8=CC=C(O)C=C8)O6)C4=C2)=CC(O)=C1
Properties
Chemical formula	C₄₂H₃₂O₉
Molar mass	680.71 g·mol⁻¹
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
N verify (what is ^YN ?)
Infobox references

trans-Diptoindonesin B is an oligomeric stilbenoid.

References

↑ Syah, YM; Aminah, NS; Hakim, EH; Aimi, N; Kitajima, M; Takayama, H; Achmad, SA (2003). "Two oligostilbenes, cis- and trans-diptoindonesin B, from Dryobalanops oblongifolia". Phytochemistry. 63 (8): 913–7. doi:10.1016/S0031-9422(03)00274-7. PMID 12895539.

Dimers

Trimers

Tetramers:

Higher polymers
(five units or more)

Oligomeric forms
of resveratrol

Dimers	Amurensin A and H Ampelopsin A B D and F Balanocarpol Cyphostemmin A and B δ-viniferin ε-viniferin Gnetin A and C Leachinol F Malibatol A Pallidol Parthenocissin A Quadrangularin A Restrytisol A, B and C Vitisinol D

Trimers	α-viniferin Ampelopsin C Amurensin C, D and G Hopeanolin Malaysianol A Miyabenol C Resviniferin A and B trans-diptoindonesin B

Tetramers	Ampelopsin H Amurensin K Caraphenol B Carasinol B Flexuosol A Hopeaphenol Kobophenol A Miyabenol A Vaticanol B and C Vaticaphenol A Vitisin A B and C β-viniferin (cyclic resveratrol tetramer)

Pentamers	Amurensin E and F

Hexamers	Chunganenol

Higher polymers	γ-viniferin Valeriaphenol A

Glycosides or conjugates

This article is issued from Wikipedia - version of the 7/30/2016. The text is available under the Creative Commons Attribution/Share Alike but additional terms may apply for the media files.