Astragalin
Astragalin
 |
| Names |
| IUPAC name
5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(2S,3R,4S,5S,6R)-3,4,
5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
| Other names
Astragaline asragalin kaempferol-3-glucoside Kaempferol 3-glucoside Kaempferol 3-O-glucoside Kaempferol-3-O-glucoside Kaempferol-3-D-glucoside Kaempferol-3-beta-monoglucoside Kaempferol 3-O-β-D-glucopyranoside |
| Identifiers |
| |
480-10-4 N |
| 3D model (Jmol) |
Interactive image |
| |
100568 |
| ChEBI |
CHEBI:30200 Y |
| ChEMBL |
ChEMBL453290 N |
| ChemSpider |
4445311 Y |
| ECHA InfoCard |
100.128.596 |
| PubChem |
5282102 |
InChI=1S/C21H20O11/c22-7-13-15(26)17(28)18(29)21(31-13)32-20-16(27)14-11(25)5-10(24)6-12(14)30-19(20)8-1-3-9(23)4-2-8/h1-6,13,15,17-18,21-26,28-29H,7H2/t13-,15-,17+,18-,21+/m1/s1 YKey: JPUKWEQWGBDDQB-QSOFNFLRSA-N YInChI=1/C21H20O11/c22-7-13-15(26)17(28)18(29)21(31-13)32-20-16(27)14-11(25)5-10(24)6-12(14)30-19(20)8-1-3-9(23)4-2-8/h1-6,13,15,17-18,21-26,28-29H,7H2/t13-,15-,17+,18-,21+/m1/s1 Key: JPUKWEQWGBDDQB-QSOFNFLRBV
|
O=C2C(\O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO)=C(/Oc3cc(O)cc(O)c23)c4ccc(O)cc4
|
| Properties |
| |
C21H20O11 |
| Molar mass |
448.37 g/mol |
| Density |
1.791 g/mL |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
N verify (what is Y N ?) |
| Infobox references |
|
|
Astragalin is a chemical compound. It can be isolated from Phytolacca americana (the American pokeweed) or in the methanolic extract of fronds of the fern Phegopteris connectilis.[1] It is also found in wine.
Astragalin is a 3-O-glucoside of kaempferol.
References
- ↑ Phenolic constituents of the fernPhegopteris connectilis. Klaus-Peter Adam, Phytochemistry, Volume 52, Issue 5, November 1999, Pages 929–934, doi:10.1016/S0031-9422(99)00326-X
Flavonols and their conjugates |
|---|
|
| Backbone | |
|---|
|
| Flavonols | Aglycones | |
|---|
| Conjugates | | |
|---|
| |
- Afzelin (Kaempferol 3-rhamnoside)
- Astragalin (kaempferol 3-O-glucoside)
- Kaempferitrin (kaempferol 3,7-dirhamnoside)
- Juglanin (Kaempferol 3-O-arabinoside)
- Kaempferol 3-alpha-L-arabinopyranoside
- Kaempferol 3-alpha-D-arabinopyranoside
- Kaempferol 7-alpha-L-arabinoside
- Kaempferol 7-O-glucoside
- Kaempferol 3-lathyroside
- Kaempferol 4'-rhamnoside
- Kaempferol 5-rhamnoside
- Kaempferol 7-rhamnoside
- Kaempferol 7-O-alpha-L-rhamnofuranoside
- Kaempferol 3-xyloside
- Kaempferol 7-xyloside
- Robinin (kaempferol-3-O-robinoside-7-O-rhamnoside)
- Kaempferol 3-O-rutinoside
- Sophoraflavonoloside (Kaempferol 3-O-sophoroside)
- Trifolin (Kaempferol 3-O-beta-D-galactoside)
|
|---|
| | |
|---|
| | |
|---|
|
|---|
|
|---|
|
| O-Methylated flavonols | Aglycones | |
|---|
| Glycosides | of isorhamnetin |
- Narcissin (Isorhamnetin 3-O-rutinoside)
- Isorhamnetin 3-O-glucoside
- Tamarixetin 7-rutinoside
|
|---|
| other |
- Azalein (Azaleatin 3-O-α-L-rhamnoside)
- Centaurein (Centaureidin 7-O-glucoside)
- Eupalin (Eupalitin 3-0-rhamnoside)
- Eupatolin (Eupatolitin 3-O-rhamnoside)
- Jacein (Jaceidin 7-O-glucoside)
- Patulitrin (Patuletin 7-O-glucoside
- Xanthorhamnin (Rhamnetin glycoside)
|
|---|
|
|---|
|
|---|
|
| Derivative flavonols | Aglycones |
- Noricaritin
- Dihydronoricaritin
|
|---|
| Glycosides | |
|---|
|
|---|
|
| Pyranoflavonols | |
|---|
|
| Furanoflavonols | |
|---|
|
| Semisynthetic | |
|---|