A-40174
A-40174
 |
| Identifiers |
|---|
- 5,5-Dimethyl-8-(3-methyloctan-2-yl)-2-prop-2-ynyl-3,4-dihydro-1H-chromeno[4,3-c]pyridin-10-ol
|
| CAS Number |
26685-57-4 N |
|---|
| PubChem (CID) |
99040 |
|---|
| ChemSpider |
89464 Y |
|---|
| ChEMBL |
CHEMBL66108 Y |
|---|
| Chemical and physical data |
|---|
| Formula |
C26H37NO2 |
|---|
| Molar mass |
395.576 g/mol |
|---|
| 3D model (Jmol) |
Interactive image |
|---|
c2c(C(C)(C)CCCCCC)cc(O)c1c2OC(C)(C)C(CC3)=C1CN3CC#C
|
InChI=1S/C26H37NO2/c1-7-9-10-11-18(3)19(4)20-15-23(28)25-21-17-27(13-8-2)14-12-22(21)26(5,6)29-24(25)16-20/h2,15-16,18-19,28H,7,9-14,17H2,1,3-6H3 YKey:PNEYWTKVWJBOMD-UHFFFAOYSA-N Y
|
N Y (what is this?) (verify) |
|---|
A-40174 (SP-1) is an analgesic drug which acts as a potent cannabinoid receptor agonist, and was developed by Abbott Laboratories in the 1970s.[1]
See also
References
- ↑ Reggio, Patricia H., ed. (2009). "The Cannabinoid Receptors". doi:10.1007/978-1-59745-503-9. ISBN 978-1-58829-712-9.
|
|---|
|
| Phytocannabinoids | |
|---|
|
| Endocannabinoids | |
|---|
|
Synthetic cannabinoids | Classical cannabinoids (dibenzopyrans) | |
|---|
| Non-classical cannabinoids | |
|---|
| | Benzoylindoles | |
|---|
| | Naphthoylindoles | |
|---|
| | Naphthoylindazoles | |
|---|
| | Pyrrolobenzoxazines | |
|---|
| | Naphthylmethylindoles | |
|---|
| | Phenylacetylindoles | |
|---|
| | Indole-3-carboxamides | |
|---|
| | Indole-3-carboxylates | |
|---|
| Tetramethylcyclo- propanoylindoles | |
|---|
| Indazole-3- carboxamides | |
|---|
| Tetramethylcyclo- propanoylindazoles | |
|---|
| | Naphthoylpyrroles | |
|---|
| | Eicosanoids | |
|---|
| | Pyrazolecarboxamides | |
|---|
| | Others | |
|---|
|
|---|
|
| Allosteric CBR ligands | |
|---|
|
Endocannabinoid enhancers (inactivation inhibitors) | |
|---|
|
Anticannabinoids (antagonists/inverse agonists/antibodies) | |
|---|
|
|