7-Phloroeckol
7-Phloroeckol
 |
| Names |
| IUPAC name
4-(3,5-dihydroxyphenoxy)-8-(2,4,6-trihydroxyphenoxy)dibenzo-p-dioxin-1,3,6-triol |
| Other names
7-Phloroethol |
| Identifiers |
| 3D model (Jmol) |
Interactive image |
| ChEBI |
CHEBI:65790 Y |
| ChemSpider |
8656347 |
| PubChem |
10480940 |
InChI=1S/C24H16O12/c25-9-1-10(26)3-12(2-9)34-22-17(31)8-18(32)23-24(22)36-21-16(30)6-13(7-19(21)35-23)33-20-14(28)4-11(27)5-15(20)29/h1-8,25-32H Key: JLEVVQRBEATTCM-UHFFFAOYSA-N InChI=1/C24H16O12/c25-9-1-10(26)3-12(2-9)34-22-17(31)8-18(32)23-24(22)36-21-16(30)6-13(7-19(21)35-23)33-20-14(28)4-11(27)5-15(20)29/h1-8,25-32H Key: JLEVVQRBEATTCM-UHFFFAOYAP
|
C1=C(C=C(C=C1O)OC2=C(C=C(C3=C2OC4=C(C=C(C=C4O3)OC5=C(C=C(C=C5O)O)O)O)O)O)O
|
| Properties |
| |
C24H16O12 |
| Molar mass |
496.37 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
| Infobox references |
|
|
7-Phloroeckol is a phlorotannin found in the edible brown algae arame (Ecklonia bicyclis) and turuarame (Ecklonia stolonifera).
References
|
|---|
|
| Monomer | |
|---|
|
| Fucols | |
|---|
|
| Phlorethols |
- Diphlorethol and diphlorethol A
- Triphloroethol A
- Tetraphlorethol A, B, C and E
- Pentaphlorethol-B
- Hexaphlorethol-A
|
|---|
|
| Fucophlorethols |
- Fucophlorethol A and B
- Fucodiphlorethol A, D and G
- Fucotriphlorethol-B, G and H
- Fucotetraphlorethol-B, J and K
- Fucopentaphlorethol-E
- Bisfucotriphlorethol-A
- Bisfucotetraphlorethol-A
- Bisfucopentaphlorethol-A and B
- Bisfucoheptaphlorethol-A
- Difucophlorethol-A
- Difucofucotriphlorethol-A and B
- Difucofucotetraphlorethol-A
- Terfucopentaphlorethol-A
- Terfucohexaphlorethol-A and B
- Terfucoheptaphlorethol-A
|
|---|
|
| Fuhalols | |
|---|
|
| Isofuhalols | |
|---|
|
| Eckols | |
|---|
|
| Halogenated phlorotannins | Bromotriphlorethol A1 |
|---|